C32H34O3S — CID 175678427
[[(2S,4R)-5-(benzenesulfonyl)-2,4-dimethylpentoxy]-diphenylmethyl]benzene (PubChem CID 175678427) has the molecular formula C32H34O3S and a molecular weight of 498.69 g/mol. Its IUPAC name is [[(2S,4R)-5-(benzenesulfonyl)-2,4-dimethylpentoxy]-diphenylmethyl]benzene.
| Compound Name | [[(2S,4R)-5-(benzenesulfonyl)-2,4-dimethylpentoxy]-diphenylmethyl]benzene |
|---|---|
| PubChem CID | 175678427 |
| Molecular Formula | C32H34O3S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | [[(2S,4R)-5-(benzenesulfonyl)-2,4-dimethylpentoxy]-diphenylmethyl]benzene |
| SMILES | C[C@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)C[C@@H](C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H34O3S/c1-26(23-27(2)25-36(33,34)31-21-13-6-14-22-31)24-35-32(28-15-7-3-8-16-28,29-17-9-4-10-18-29)30-19-11-5-12-20-30/h3-22,26-27H,23-25H2,1-2H3/t26-,27+/m0/s1 |
| InChIKey | VQEIPCILAKOVTI-RRPNLBNLSA-N |
| XLogP | 7.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|