C55H66O12S — CID 165061448
2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethanol;2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethyl methanesulfonate (PubChem CID 165061448) has the molecular formula C55H66O12S and a molecular weight of 951.19 g/mol. Its IUPAC name is 2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethanol;2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethanol;2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 165061448 |
| Molecular Formula | C55H66O12S |
| Molecular Weight | 951.19 g/mol |
| Exact Mass | 950.43 |
| IUPAC Name | 2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethanol;2-[2-[2-(2-trityloxyethoxy)ethoxy]ethoxy]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOCCOCCOCCOC(c1ccccc1)(c1ccccc1)c1ccccc1.OCCOCCOCCOCCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H34O7S.C27H32O5/c1-36(29,30)35-24-22-33-20-18-31-17-19-32-21-23-34-28(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27;28-16-17-29-18-19-30-20-21-31-22-23-32-27(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h2-16H,17-24H2,1H3;1-15,28H,16-23H2 |
| InChIKey | RGTSRTSCGNPJJV-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.19 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|