C30H30O5S — CID 86650226
(1-phenylmethoxy-3-trityloxypropan-2-yl) methanesulfonate (PubChem CID 86650226) has the molecular formula C30H30O5S and a molecular weight of 502.63 g/mol. Its IUPAC name is (1-phenylmethoxy-3-trityloxypropan-2-yl) methanesulfonate.
| Compound Name | (1-phenylmethoxy-3-trityloxypropan-2-yl) methanesulfonate |
|---|---|
| PubChem CID | 86650226 |
| Molecular Formula | C30H30O5S |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | (1-phenylmethoxy-3-trityloxypropan-2-yl) methanesulfonate |
| SMILES | CS(=O)(=O)OC(COCc1ccccc1)COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H30O5S/c1-36(31,32)35-29(23-33-22-25-14-6-2-7-15-25)24-34-30(26-16-8-3-9-17-26,27-18-10-4-11-19-27)28-20-12-5-13-21-28/h2-21,29H,22-24H2,1H3 |
| InChIKey | ZJXRVQFLHOVXIN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|