C26H28N2O5S — CID 87799611
[(2R)-5-(2-benzhydrylidenehydrazinyl)-5-oxo-1-phenylmethoxypentan-2-yl] methanesulfonate (PubChem CID 87799611) has the molecular formula C26H28N2O5S and a molecular weight of 480.59 g/mol. Its IUPAC name is [(2R)-5-(2-benzhydrylidenehydrazinyl)-5-oxo-1-phenylmethoxypentan-2-yl] methanesulfonate.
| Compound Name | [(2R)-5-(2-benzhydrylidenehydrazinyl)-5-oxo-1-phenylmethoxypentan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 87799611 |
| Molecular Formula | C26H28N2O5S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [(2R)-5-(2-benzhydrylidenehydrazinyl)-5-oxo-1-phenylmethoxypentan-2-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H](CCC(=O)NN=C(c1ccccc1)c1ccccc1)COCc1ccccc1 |
| InChI | InChI=1S/C26H28N2O5S/c1-34(30,31)33-24(20-32-19-21-11-5-2-6-12-21)17-18-25(29)27-28-26(22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,24H,17-20H2,1H3,(H,27,29)/t24-/m1/s1 |
| InChIKey | XAQSVDMEEXNPPS-XMMPIXPASA-N |
| XLogP | 3.90 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|