C37H34O4 — CID 10578419
(3S)-3,4-bis(phenylmethoxy)-1-trityloxybutan-2-one (PubChem CID 10578419) has the molecular formula C37H34O4 and a molecular weight of 542.68 g/mol. Its IUPAC name is (3S)-3,4-bis(phenylmethoxy)-1-trityloxybutan-2-one.
| Compound Name | (3S)-3,4-bis(phenylmethoxy)-1-trityloxybutan-2-one |
|---|---|
| PubChem CID | 10578419 |
| Molecular Formula | C37H34O4 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | (3S)-3,4-bis(phenylmethoxy)-1-trityloxybutan-2-one |
| SMILES | O=C(COC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@H](COCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C37H34O4/c38-35(36(40-27-31-18-8-2-9-19-31)29-39-26-30-16-6-1-7-17-30)28-41-37(32-20-10-3-11-21-32,33-22-12-4-13-23-33)34-24-14-5-15-25-34/h1-25,36H,26-29H2/t36-/m0/s1 |
| InChIKey | GFDNBPCEFQTINI-BHVANESWSA-N |
| XLogP | 7.37 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|