2-bromo-3-phenylmethoxypropanoyl chloride

C10H10BrClO2 — CID 154663472

IUPAC2-bromo-3-phenylmethoxypropanoyl chloride
SMILESO=C(Cl)C(Br)COCc1ccccc1
InChIInChI=1S/C10H10BrClO2/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2
InChIKeyARVWUDRWSIJSSB-UHFFFAOYSA-N
MW277.55 g/mol
LogP2.73
Rot. Bonds5

About 2-bromo-3-phenylmethoxypropanoyl chloride

2-bromo-3-phenylmethoxypropanoyl chloride (PubChem CID 154663472) has the molecular formula C10H10BrClO2 and a molecular weight of 277.55 g/mol. Its IUPAC name is 2-bromo-3-phenylmethoxypropanoyl chloride.

Molecular Properties

Compound Name2-bromo-3-phenylmethoxypropanoyl chloride
PubChem CID154663472
Molecular FormulaC10H10BrClO2
Molecular Weight277.55 g/mol
Exact Mass275.96
IUPAC Name2-bromo-3-phenylmethoxypropanoyl chloride
SMILESO=C(Cl)C(Br)COCc1ccccc1
InChIInChI=1S/C10H10BrClO2/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2
InChIKeyARVWUDRWSIJSSB-UHFFFAOYSA-N
XLogP2.73
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.55
LogP ≤ 52.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 2-bromo-3-phenylmethoxypropanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-3-phenylmethoxypropanoyl chloride?
The IUPAC name of 2-bromo-3-phenylmethoxypropanoyl chloride (CID 154663472) is 2-bromo-3-phenylmethoxypropanoyl chloride.
What is the SMILES notation for 2-bromo-3-phenylmethoxypropanoyl chloride?
The canonical SMILES for 2-bromo-3-phenylmethoxypropanoyl chloride is O=C(Cl)C(Br)COCc1ccccc1.
What is the InChIKey of 2-bromo-3-phenylmethoxypropanoyl chloride?
The InChIKey is ARVWUDRWSIJSSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrClO2/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2.
What are the key properties of 2-bromo-3-phenylmethoxypropanoyl chloride?
2-bromo-3-phenylmethoxypropanoyl chloride has a molecular weight of 277.55 g/mol, XLogP of 2.73, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-phenylmethoxypropanoyl chloride is sourced from PubChem (CID 154663472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).