About (1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+)
(1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+) (PubChem CID 20617400) has the molecular formula C10H12NO3Pt+
and a molecular weight of 389.29 g/mol. Its IUPAC name is (1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+).
Molecular Properties
| Compound Name | (1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+) |
| PubChem CID | 20617400 |
| Molecular Formula | C10H12NO3Pt+ |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | (1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+) |
| SMILES | [NH-]C(COCc1ccccc1)C(=O)O.[Pt+2] |
| InChI | InChI=1S/C10H12NO3.Pt/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8;/h1-5,9,11H,6-7H2,(H,12,13);/q-1;+2 |
| InChIKey | XIQWATYUQZACTC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 70.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+)?
The IUPAC name of (1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+) (CID 20617400) is (1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+).
What is the SMILES notation for (1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+)?
The canonical SMILES for (1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+) is [NH-]C(COCc1ccccc1)C(=O)O.[Pt+2].
What is the InChIKey of (1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+)?
The InChIKey is XIQWATYUQZACTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12NO3.Pt/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8;/h1-5,9,11H,6-7H2,(H,12,13);/q-1;+2.
What are the key properties of (1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+)?
(1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+) has a molecular weight of 389.29 g/mol, XLogP of 1.71, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carboxy-2-phenylmethoxyethyl)azanide;platinum(2+) is sourced from PubChem (CID 20617400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).