C11H14N2O4 — CID 174753474
[(2S)-1-amino-1-oxo-3-phenylmethoxypropan-2-yl] carbamate (PubChem CID 174753474) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxo-3-phenylmethoxypropan-2-yl] carbamate.
| Compound Name | [(2S)-1-amino-1-oxo-3-phenylmethoxypropan-2-yl] carbamate |
|---|---|
| PubChem CID | 174753474 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | [(2S)-1-amino-1-oxo-3-phenylmethoxypropan-2-yl] carbamate |
| SMILES | NC(=O)O[C@@H](COCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C11H14N2O4/c12-10(14)9(17-11(13)15)7-16-6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,12,14)(H2,13,15)/t9-/m0/s1 |
| InChIKey | UNJBXSVDCKEDRF-VIFPVBQESA-N |
| XLogP | 0.15 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |