C45H43N3O4 — CID 10996058
[(2R,3R,4S)-4-azido-2,5-bis(phenylmethoxy)-1-trityloxypentan-3-yl]oxymethylbenzene (PubChem CID 10996058) has the molecular formula C45H43N3O4 and a molecular weight of 689.86 g/mol. Its IUPAC name is [(2R,3R,4S)-4-azido-2,5-bis(phenylmethoxy)-1-trityloxypentan-3-yl]oxymethylbenzene.
| Compound Name | [(2R,3R,4S)-4-azido-2,5-bis(phenylmethoxy)-1-trityloxypentan-3-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 10996058 |
| Molecular Formula | C45H43N3O4 |
| Molecular Weight | 689.86 g/mol |
| Exact Mass | 689.33 |
| IUPAC Name | [(2R,3R,4S)-4-azido-2,5-bis(phenylmethoxy)-1-trityloxypentan-3-yl]oxymethylbenzene |
| SMILES | [N-]=[N+]=N[C@@H](COCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](COC(c1ccccc1)(c1ccccc1)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C45H43N3O4/c46-48-47-42(34-49-31-36-19-7-1-8-20-36)44(51-33-38-23-11-3-12-24-38)43(50-32-37-21-9-2-10-22-37)35-52-45(39-25-13-4-14-26-39,40-27-15-5-16-28-40)41-29-17-6-18-30-41/h1-30,42-44H,31-35H2/t42-,43+,44+/m0/s1 |
| InChIKey | JBTXFRVXPNRWSN-HHWNUHTHSA-N |
| XLogP | 10.06 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.86 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|