C26H39N3O5Si — CID 102160249
(2S,3S,4S)-4-azido-1-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-3-phenylmethoxypentan-2-ol (PubChem CID 102160249) has the molecular formula C26H39N3O5Si and a molecular weight of 501.70 g/mol. Its IUPAC name is (2S,3S,4S)-4-azido-1-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-3-phenylmethoxypentan-2-ol.
| Compound Name | (2S,3S,4S)-4-azido-1-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-3-phenylmethoxypentan-2-ol |
|---|---|
| PubChem CID | 102160249 |
| Molecular Formula | C26H39N3O5Si |
| Molecular Weight | 501.70 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | (2S,3S,4S)-4-azido-1-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-3-phenylmethoxypentan-2-ol |
| SMILES | COc1ccc(COC[C@H](N=[N+]=[N-])[C@H](OCc2ccccc2)[C@@H](O)CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H39N3O5Si/c1-26(2,3)35(5,6)34-19-24(30)25(33-17-20-10-8-7-9-11-20)23(28-29-27)18-32-16-21-12-14-22(31-4)15-13-21/h7-15,23-25,30H,16-19H2,1-6H3/t23-,24-,25-/m0/s1 |
| InChIKey | XAOYVBAGPDQXDE-SDHOMARFSA-N |
| XLogP | 5.86 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.70 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|