C31H40O6S3 — CID 71500094
[(2R,3R,4R)-5,5-bis(ethylsulfanyl)-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate (PubChem CID 71500094) has the molecular formula C31H40O6S3 and a molecular weight of 604.86 g/mol. Its IUPAC name is [(2R,3R,4R)-5,5-bis(ethylsulfanyl)-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate.
| Compound Name | [(2R,3R,4R)-5,5-bis(ethylsulfanyl)-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 71500094 |
| Molecular Formula | C31H40O6S3 |
| Molecular Weight | 604.86 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | [(2R,3R,4R)-5,5-bis(ethylsulfanyl)-1,3,4-tris(phenylmethoxy)pentan-2-yl] methanesulfonate |
| SMILES | CCSC(SCC)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C31H40O6S3/c1-4-38-31(39-5-2)30(36-23-27-19-13-8-14-20-27)29(35-22-26-17-11-7-12-18-26)28(37-40(3,32)33)24-34-21-25-15-9-6-10-16-25/h6-20,28-31H,4-5,21-24H2,1-3H3/t28-,29+,30-/m1/s1 |
| InChIKey | HNVQJKDAPQIUEB-DYIKCSJPSA-N |
| XLogP | 6.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.86 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|