C43H57NO8S2Si — CID 135032243
ethyl (1Z,2S,3S,4S,5R)-N-[tert-butyl(dimethyl)silyl]oxy-5-methylsulfonyloxy-2,3,4,6-tetrakis(phenylmethoxy)hexanimidothioate (PubChem CID 135032243) has the molecular formula C43H57NO8S2Si and a molecular weight of 808.15 g/mol. Its IUPAC name is ethyl (1Z,2S,3S,4S,5R)-N-[tert-butyl(dimethyl)silyl]oxy-5-methylsulfonyloxy-2,3,4,6-tetrakis(phenylmethoxy)hexanimidothioate.
| Compound Name | ethyl (1Z,2S,3S,4S,5R)-N-[tert-butyl(dimethyl)silyl]oxy-5-methylsulfonyloxy-2,3,4,6-tetrakis(phenylmethoxy)hexanimidothioate |
|---|---|
| PubChem CID | 135032243 |
| Molecular Formula | C43H57NO8S2Si |
| Molecular Weight | 808.15 g/mol |
| Exact Mass | 807.33 |
| IUPAC Name | ethyl (1Z,2S,3S,4S,5R)-N-[tert-butyl(dimethyl)silyl]oxy-5-methylsulfonyloxy-2,3,4,6-tetrakis(phenylmethoxy)hexanimidothioate |
| SMILES | CCS/C(=N\O[Si](C)(C)C(C)(C)C)[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OS(C)(=O)=O |
| InChI | InChI=1S/C43H57NO8S2Si/c1-8-53-42(44-52-55(6,7)43(2,3)4)41(50-32-37-27-19-12-20-28-37)40(49-31-36-25-17-11-18-26-36)39(48-30-35-23-15-10-16-24-35)38(51-54(5,45)46)33-47-29-34-21-13-9-14-22-34/h9-28,38-41H,8,29-33H2,1-7H3/b44-42-/t38-,39-,40+,41+/m1/s1 |
| InChIKey | FTXVKUBRUYKEGX-FUYGPTTISA-N |
| XLogP | 9.39 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.15 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|