C36H36F6O10S2 — CID 10373193
[(2S,3R,4S,5R)-2,3,4,6-tetrakis(phenylmethoxy)-5-(trifluoromethylsulfonyloxy)hexyl] trifluoromethanesulfonate (PubChem CID 10373193) has the molecular formula C36H36F6O10S2 and a molecular weight of 806.80 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-2,3,4,6-tetrakis(phenylmethoxy)-5-(trifluoromethylsulfonyloxy)hexyl] trifluoromethanesulfonate.
| Compound Name | [(2S,3R,4S,5R)-2,3,4,6-tetrakis(phenylmethoxy)-5-(trifluoromethylsulfonyloxy)hexyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10373193 |
| Molecular Formula | C36H36F6O10S2 |
| Molecular Weight | 806.80 g/mol |
| Exact Mass | 806.17 |
| IUPAC Name | [(2S,3R,4S,5R)-2,3,4,6-tetrakis(phenylmethoxy)-5-(trifluoromethylsulfonyloxy)hexyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C36H36F6O10S2/c37-35(38,39)53(43,44)51-26-31(48-22-28-15-7-2-8-16-28)33(49-23-29-17-9-3-10-18-29)34(50-24-30-19-11-4-12-20-30)32(52-54(45,46)36(40,41)42)25-47-21-27-13-5-1-6-14-27/h1-20,31-34H,21-26H2/t31-,32+,33+,34+/m0/s1 |
| InChIKey | LYQSQMAMAHPGLA-KRFMAMIKSA-N |
| XLogP | 7.06 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.80 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|