C29H37FN2O7S2 — CID 132535543
[(2S,3R,4S,5S)-5-tert-butylsulfanyl-4-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-bis(phenylmethoxy)pentan-2-yl] methanesulfonate (PubChem CID 132535543) has the molecular formula C29H37FN2O7S2 and a molecular weight of 608.75 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-5-tert-butylsulfanyl-4-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-bis(phenylmethoxy)pentan-2-yl] methanesulfonate.
| Compound Name | [(2S,3R,4S,5S)-5-tert-butylsulfanyl-4-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-bis(phenylmethoxy)pentan-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 132535543 |
| Molecular Formula | C29H37FN2O7S2 |
| Molecular Weight | 608.75 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | [(2S,3R,4S,5S)-5-tert-butylsulfanyl-4-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,3-bis(phenylmethoxy)pentan-2-yl] methanesulfonate |
| SMILES | Cc1cn([C@@H](SC(C)(C)C)[C@@H](F)[C@H](OCc2ccccc2)[C@H](COCc2ccccc2)OS(C)(=O)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C29H37FN2O7S2/c1-20-16-32(28(34)31-26(20)33)27(40-29(2,3)4)24(30)25(38-18-22-14-10-7-11-15-22)23(39-41(5,35)36)19-37-17-21-12-8-6-9-13-21/h6-16,23-25,27H,17-19H2,1-5H3,(H,31,33,34)/t23-,24-,25+,27-/m0/s1 |
| InChIKey | FMVZTJARQVHWRO-CLPFNFTISA-N |
| XLogP | 4.36 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.75 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|