C27H40N2O5Si — CID 142510022
1-[(1R)-1-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyhex-5-en-2-yl]oxyprop-2-enyl]-5-methylpyrimidine-2,4-dione (PubChem CID 142510022) has the molecular formula C27H40N2O5Si and a molecular weight of 500.71 g/mol. Its IUPAC name is 1-[(1R)-1-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyhex-5-en-2-yl]oxyprop-2-enyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(1R)-1-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyhex-5-en-2-yl]oxyprop-2-enyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142510022 |
| Molecular Formula | C27H40N2O5Si |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 1-[(1R)-1-[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyhex-5-en-2-yl]oxyprop-2-enyl]-5-methylpyrimidine-2,4-dione |
| SMILES | C=CC[C@H](OCc1ccccc1)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](C=C)n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C27H40N2O5Si/c1-9-14-22(32-18-21-15-12-11-13-16-21)23(19-33-35(7,8)27(4,5)6)34-24(10-2)29-17-20(3)25(30)28-26(29)31/h9-13,15-17,22-24H,1-2,14,18-19H2,3-8H3,(H,28,30,31)/t22-,23+,24+/m0/s1 |
| InChIKey | UFEYKEGEFBCFNJ-RBZQAINGSA-N |
| XLogP | 5.10 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|