C42H54O5S2Si — CID 102308416
tert-butyl-[(2R,3S,4S,5R)-5-(1,3-dithiolan-2-yl)-2,3,4,5-tetrakis(phenylmethoxy)pentoxy]-dimethylsilane (PubChem CID 102308416) has the molecular formula C42H54O5S2Si and a molecular weight of 731.11 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,4S,5R)-5-(1,3-dithiolan-2-yl)-2,3,4,5-tetrakis(phenylmethoxy)pentoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S,4S,5R)-5-(1,3-dithiolan-2-yl)-2,3,4,5-tetrakis(phenylmethoxy)pentoxy]-dimethylsilane |
|---|---|
| PubChem CID | 102308416 |
| Molecular Formula | C42H54O5S2Si |
| Molecular Weight | 731.11 g/mol |
| Exact Mass | 730.32 |
| IUPAC Name | tert-butyl-[(2R,3S,4S,5R)-5-(1,3-dithiolan-2-yl)-2,3,4,5-tetrakis(phenylmethoxy)pentoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C1SCCS1 |
| InChI | InChI=1S/C42H54O5S2Si/c1-42(2,3)50(4,5)47-32-37(43-28-33-18-10-6-11-19-33)38(44-29-34-20-12-7-13-21-34)39(45-30-35-22-14-8-15-23-35)40(41-48-26-27-49-41)46-31-36-24-16-9-17-25-36/h6-25,37-41H,26-32H2,1-5H3/t37-,38+,39+,40-/m1/s1 |
| InChIKey | QMERNXVCTFZHFU-ROZBJHDGSA-N |
| XLogP | 10.16 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.11 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|