C37H40O5S2 — CID 71658825
(2S,3S,4S,5R)-5-(1,3-dithian-2-yl)-2,3,4,5-tetrakis(phenylmethoxy)pentanal (PubChem CID 71658825) has the molecular formula C37H40O5S2 and a molecular weight of 628.86 g/mol. Its IUPAC name is (2S,3S,4S,5R)-5-(1,3-dithian-2-yl)-2,3,4,5-tetrakis(phenylmethoxy)pentanal.
| Compound Name | (2S,3S,4S,5R)-5-(1,3-dithian-2-yl)-2,3,4,5-tetrakis(phenylmethoxy)pentanal |
|---|---|
| PubChem CID | 71658825 |
| Molecular Formula | C37H40O5S2 |
| Molecular Weight | 628.86 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | (2S,3S,4S,5R)-5-(1,3-dithian-2-yl)-2,3,4,5-tetrakis(phenylmethoxy)pentanal |
| SMILES | O=C[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)C1SCCCS1 |
| InChI | InChI=1S/C37H40O5S2/c38-24-33(39-25-29-14-5-1-6-15-29)34(40-26-30-16-7-2-8-17-30)35(41-27-31-18-9-3-10-19-31)36(37-43-22-13-23-44-37)42-28-32-20-11-4-12-21-32/h1-12,14-21,24,33-37H,13,22-23,25-28H2/t33-,34-,35+,36-/m1/s1 |
| InChIKey | ZVJNYUVWWBBUFW-PEDCNLCOSA-N |
| XLogP | 7.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.86 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|