C29H32O5 — CID 100963665
(2R,3R,4R)-2,3,4-tris(phenylmethoxy)-5-prop-2-enoxypentanal (PubChem CID 100963665) has the molecular formula C29H32O5 and a molecular weight of 460.57 g/mol. Its IUPAC name is (2R,3R,4R)-2,3,4-tris(phenylmethoxy)-5-prop-2-enoxypentanal.
| Compound Name | (2R,3R,4R)-2,3,4-tris(phenylmethoxy)-5-prop-2-enoxypentanal |
|---|---|
| PubChem CID | 100963665 |
| Molecular Formula | C29H32O5 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (2R,3R,4R)-2,3,4-tris(phenylmethoxy)-5-prop-2-enoxypentanal |
| SMILES | C=CCOC[C@@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H32O5/c1-2-18-31-23-28(33-21-25-14-8-4-9-15-25)29(34-22-26-16-10-5-11-17-26)27(19-30)32-20-24-12-6-3-7-13-24/h2-17,19,27-29H,1,18,20-23H2/t27-,28+,29-/m0/s1 |
| InChIKey | HFIBUAAMEMOSAO-NHKHRBQYSA-N |
| XLogP | 5.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|