C26H27N3O4 — CID 18654073
(2R,3S,4R)-5-azido-2,3,4-tris(phenylmethoxy)pentanal (PubChem CID 18654073) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is (2R,3S,4R)-5-azido-2,3,4-tris(phenylmethoxy)pentanal.
| Compound Name | (2R,3S,4R)-5-azido-2,3,4-tris(phenylmethoxy)pentanal |
|---|---|
| PubChem CID | 18654073 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | (2R,3S,4R)-5-azido-2,3,4-tris(phenylmethoxy)pentanal |
| SMILES | [N-]=[N+]=NC[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](C=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H27N3O4/c27-29-28-16-24(31-18-21-10-4-1-5-11-21)26(33-20-23-14-8-3-9-15-23)25(17-30)32-19-22-12-6-2-7-13-22/h1-15,17,24-26H,16,18-20H2/t24-,25+,26+/m1/s1 |
| InChIKey | HNNWMTULEISXRU-ZNZIZOMTSA-N |
| XLogP | 5.25 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|