C38H43BrN6O4 — CID 159201946
(2S,3R)-1-azido-3-phenylmethoxypent-4-en-2-ol;[(2S,3R)-1-azido-2-phenylmethoxypent-4-en-3-yl]oxymethylbenzene;bromomethylbenzene (PubChem CID 159201946) has the molecular formula C38H43BrN6O4 and a molecular weight of 727.70 g/mol. Its IUPAC name is (2S,3R)-1-azido-3-phenylmethoxypent-4-en-2-ol;[(2S,3R)-1-azido-2-phenylmethoxypent-4-en-3-yl]oxymethylbenzene;bromomethylbenzene.
| Compound Name | (2S,3R)-1-azido-3-phenylmethoxypent-4-en-2-ol;[(2S,3R)-1-azido-2-phenylmethoxypent-4-en-3-yl]oxymethylbenzene;bromomethylbenzene |
|---|---|
| PubChem CID | 159201946 |
| Molecular Formula | C38H43BrN6O4 |
| Molecular Weight | 727.70 g/mol |
| Exact Mass | 726.25 |
| IUPAC Name | (2S,3R)-1-azido-3-phenylmethoxypent-4-en-2-ol;[(2S,3R)-1-azido-2-phenylmethoxypent-4-en-3-yl]oxymethylbenzene;bromomethylbenzene |
| SMILES | BrCc1ccccc1.C=C[C@@H](OCc1ccccc1)[C@@H](O)CN=[N+]=[N-].C=C[C@@H](OCc1ccccc1)[C@H](CN=[N+]=[N-])OCc1ccccc1 |
| InChI | InChI=1S/C19H21N3O2.C12H15N3O2.C7H7Br/c1-2-18(23-14-16-9-5-3-6-10-16)19(13-21-22-20)24-15-17-11-7-4-8-12-17;1-2-12(11(16)8-14-15-13)17-9-10-6-4-3-5-7-10;8-6-7-4-2-1-3-5-7/h2-12,18-19H,1,13-15H2;2-7,11-12,16H,1,8-9H2;1-5H,6H2/t18-,19+;11-,12+;/m10./s1 |
| InChIKey | KPKBJSFPAXHJOH-NRHUQSLLSA-N |
| XLogP | 9.66 |
| TPSA | 145.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.70 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|