C14H20N3O6P — CID 101189575
[(1R,2S)-3-azido-1-dimethoxyphosphoryl-2-phenylmethoxypropyl] acetate (PubChem CID 101189575) has the molecular formula C14H20N3O6P and a molecular weight of 357.30 g/mol. Its IUPAC name is [(1R,2S)-3-azido-1-dimethoxyphosphoryl-2-phenylmethoxypropyl] acetate.
| Compound Name | [(1R,2S)-3-azido-1-dimethoxyphosphoryl-2-phenylmethoxypropyl] acetate |
|---|---|
| PubChem CID | 101189575 |
| Molecular Formula | C14H20N3O6P |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | [(1R,2S)-3-azido-1-dimethoxyphosphoryl-2-phenylmethoxypropyl] acetate |
| SMILES | COP(=O)(OC)[C@@H](OC(C)=O)[C@H](CN=[N+]=[N-])OCc1ccccc1 |
| InChI | InChI=1S/C14H20N3O6P/c1-11(18)23-14(24(19,20-2)21-3)13(9-16-17-15)22-10-12-7-5-4-6-8-12/h4-8,13-14H,9-10H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | FYRGAKIOVBAPLB-UONOGXRCSA-N |
| XLogP | 3.26 |
| TPSA | 119.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|