C12H15N3O3 — CID 157294780
(2R,3R)-4-azido-3-methyl-2-phenylmethoxybutanoic acid (PubChem CID 157294780) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2R,3R)-4-azido-3-methyl-2-phenylmethoxybutanoic acid.
| Compound Name | (2R,3R)-4-azido-3-methyl-2-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 157294780 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (2R,3R)-4-azido-3-methyl-2-phenylmethoxybutanoic acid |
| SMILES | C[C@H](CN=[N+]=[N-])[C@@H](OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H15N3O3/c1-9(7-14-15-13)11(12(16)17)18-8-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3,(H,16,17)/t9-,11-/m1/s1 |
| InChIKey | UARBHVVWQOPQBL-MWLCHTKSSA-N |
| XLogP | 2.60 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|