C14H18N2O2 — CID 102020012
(3S,4S)-1-diazo-4-methyl-3-phenylmethoxyhexan-2-one (PubChem CID 102020012) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (3S,4S)-1-diazo-4-methyl-3-phenylmethoxyhexan-2-one.
| Compound Name | (3S,4S)-1-diazo-4-methyl-3-phenylmethoxyhexan-2-one |
|---|---|
| PubChem CID | 102020012 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (3S,4S)-1-diazo-4-methyl-3-phenylmethoxyhexan-2-one |
| SMILES | CC[C@H](C)[C@H](OCc1ccccc1)C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C14H18N2O2/c1-3-11(2)14(13(17)9-16-15)18-10-12-7-5-4-6-8-12/h4-9,11,14H,3,10H2,1-2H3/t11-,14-/m0/s1 |
| InChIKey | PYSDEYXOWXBULJ-FZMZJTMJSA-N |
| XLogP | 2.49 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|