C19H28N4O5 — CID 173253616
5-diazo-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid;N,N-diethylethanamine (PubChem CID 173253616) has the molecular formula C19H28N4O5 and a molecular weight of 392.46 g/mol. Its IUPAC name is 5-diazo-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid;N,N-diethylethanamine.
| Compound Name | 5-diazo-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 173253616 |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 5-diazo-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.[N-]=[N+]=CC(=O)C(CC(=O)O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H13N3O5.C6H15N/c14-15-7-11(17)10(6-12(18)19)16-13(20)21-8-9-4-2-1-3-5-9;1-4-7(5-2)6-3/h1-5,7,10H,6,8H2,(H,16,20)(H,18,19);4-6H2,1-3H3 |
| InChIKey | AZSYDHICQKCKJV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 132.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|