C28H26N4O5 — CID 137068048
benzyl N-[(2R)-1-[[(2S)-5-diazo-3,4-dioxo-1-phenylpentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 137068048) has the molecular formula C28H26N4O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is benzyl N-[(2R)-1-[[(2S)-5-diazo-3,4-dioxo-1-phenylpentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2R)-1-[[(2S)-5-diazo-3,4-dioxo-1-phenylpentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 137068048 |
| Molecular Formula | C28H26N4O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | benzyl N-[(2R)-1-[[(2S)-5-diazo-3,4-dioxo-1-phenylpentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | [N-]=[N+]=CC(=O)C(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H26N4O5/c29-30-18-25(33)26(34)23(16-20-10-4-1-5-11-20)31-27(35)24(17-21-12-6-2-7-13-21)32-28(36)37-19-22-14-8-3-9-15-22/h1-15,18,23-24H,16-17,19H2,(H,31,35)(H,32,36)/t23-,24+/m0/s1 |
| InChIKey | ALAWWLVJGWQCGB-BJKOFHAPSA-N |
| XLogP | 2.69 |
| TPSA | 137.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|