C21H27N5O3 — CID 62706272
methyl (2R,3R,4R)-3-amino-5-azido-2-[benzyl(methyl)amino]-4-phenylmethoxypentanoate (PubChem CID 62706272) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is methyl (2R,3R,4R)-3-amino-5-azido-2-[benzyl(methyl)amino]-4-phenylmethoxypentanoate.
| Compound Name | methyl (2R,3R,4R)-3-amino-5-azido-2-[benzyl(methyl)amino]-4-phenylmethoxypentanoate |
|---|---|
| PubChem CID | 62706272 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | methyl (2R,3R,4R)-3-amino-5-azido-2-[benzyl(methyl)amino]-4-phenylmethoxypentanoate |
| SMILES | COC(=O)[C@@H]([C@@H](N)[C@@H](CN=[N+]=[N-])OCc1ccccc1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C21H27N5O3/c1-26(14-16-9-5-3-6-10-16)20(21(27)28-2)19(22)18(13-24-25-23)29-15-17-11-7-4-8-12-17/h3-12,18-20H,13-15,22H2,1-2H3/t18-,19+,20-/m1/s1 |
| InChIKey | BRKXCFKBEHEHMJ-HSALFYBXSA-N |
| XLogP | 2.88 |
| TPSA | 113.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|