C20H23NO3 — CID 23240840
(NZ)-N-[(3R,4R)-3,4-bis(phenylmethoxy)hex-5-enylidene]hydroxylamine (PubChem CID 23240840) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (NZ)-N-[(3R,4R)-3,4-bis(phenylmethoxy)hex-5-enylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(3R,4R)-3,4-bis(phenylmethoxy)hex-5-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 23240840 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (NZ)-N-[(3R,4R)-3,4-bis(phenylmethoxy)hex-5-enylidene]hydroxylamine |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@@H](C/C=N\O)OCc1ccccc1 |
| InChI | InChI=1S/C20H23NO3/c1-2-19(23-15-17-9-5-3-6-10-17)20(13-14-21-22)24-16-18-11-7-4-8-12-18/h2-12,14,19-20,22H,1,13,15-16H2/b21-14-/t19-,20-/m1/s1 |
| InChIKey | SUHNGKLLLGCXTM-XMCGGYMHSA-N |
| XLogP | 4.19 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|