C38H43NO4 — CID 46915682
(2R,3R)-N-[(2R,3R)-2,3-bis(phenylmethoxy)pent-4-enyl]-2,3-bis(phenylmethoxy)pent-4-en-1-amine (PubChem CID 46915682) has the molecular formula C38H43NO4 and a molecular weight of 577.77 g/mol. Its IUPAC name is (2R,3R)-N-[(2R,3R)-2,3-bis(phenylmethoxy)pent-4-enyl]-2,3-bis(phenylmethoxy)pent-4-en-1-amine.
| Compound Name | (2R,3R)-N-[(2R,3R)-2,3-bis(phenylmethoxy)pent-4-enyl]-2,3-bis(phenylmethoxy)pent-4-en-1-amine |
|---|---|
| PubChem CID | 46915682 |
| Molecular Formula | C38H43NO4 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | (2R,3R)-N-[(2R,3R)-2,3-bis(phenylmethoxy)pent-4-enyl]-2,3-bis(phenylmethoxy)pent-4-en-1-amine |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@@H](CNC[C@@H](OCc1ccccc1)[C@@H](C=C)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C38H43NO4/c1-3-35(40-27-31-17-9-5-10-18-31)37(42-29-33-21-13-7-14-22-33)25-39-26-38(43-30-34-23-15-8-16-24-34)36(4-2)41-28-32-19-11-6-12-20-32/h3-24,35-39H,1-2,25-30H2/t35-,36-,37-,38-/m1/s1 |
| InChIKey | LKJLVSYADPHLPT-SIMZDOAPSA-N |
| XLogP | 7.29 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|