C36H36O4 — CID 11082024
[(1R,2R,3R)-2,3-bis(phenylmethoxy)-1-[(1S)-1-phenylmethoxyprop-2-ynyl]pent-4-enoxy]methylbenzene (PubChem CID 11082024) has the molecular formula C36H36O4 and a molecular weight of 532.68 g/mol. Its IUPAC name is [(1R,2R,3R)-2,3-bis(phenylmethoxy)-1-[(1S)-1-phenylmethoxyprop-2-ynyl]pent-4-enoxy]methylbenzene.
| Compound Name | [(1R,2R,3R)-2,3-bis(phenylmethoxy)-1-[(1S)-1-phenylmethoxyprop-2-ynyl]pent-4-enoxy]methylbenzene |
|---|---|
| PubChem CID | 11082024 |
| Molecular Formula | C36H36O4 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | [(1R,2R,3R)-2,3-bis(phenylmethoxy)-1-[(1S)-1-phenylmethoxyprop-2-ynyl]pent-4-enoxy]methylbenzene |
| SMILES | C#C[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](C=C)OCc1ccccc1 |
| InChI | InChI=1S/C36H36O4/c1-3-33(37-25-29-17-9-5-10-18-29)35(39-27-31-21-13-7-14-22-31)36(40-28-32-23-15-8-16-24-32)34(4-2)38-26-30-19-11-6-12-20-30/h1,4-24,33-36H,2,25-28H2/t33-,34+,35+,36+/m0/s1 |
| InChIKey | AGQHWEURVVEBKK-NJMTUYGZSA-N |
| XLogP | 7.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|