C38H52O4Si — CID 59435867
tri(propan-2-yl)-[(4S)-4,5,6-tris(phenylmethoxy)octa-1,7-dien-3-yl]oxysilane (PubChem CID 59435867) has the molecular formula C38H52O4Si and a molecular weight of 600.92 g/mol. Its IUPAC name is tri(propan-2-yl)-[(4S)-4,5,6-tris(phenylmethoxy)octa-1,7-dien-3-yl]oxysilane.
| Compound Name | tri(propan-2-yl)-[(4S)-4,5,6-tris(phenylmethoxy)octa-1,7-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 59435867 |
| Molecular Formula | C38H52O4Si |
| Molecular Weight | 600.92 g/mol |
| Exact Mass | 600.36 |
| IUPAC Name | tri(propan-2-yl)-[(4S)-4,5,6-tris(phenylmethoxy)octa-1,7-dien-3-yl]oxysilane |
| SMILES | C=CC(OCc1ccccc1)C(OCc1ccccc1)[C@H](OCc1ccccc1)C(C=C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H52O4Si/c1-9-35(39-26-32-20-14-11-15-21-32)37(40-27-33-22-16-12-17-23-33)38(41-28-34-24-18-13-19-25-34)36(10-2)42-43(29(3)4,30(5)6)31(7)8/h9-25,29-31,35-38H,1-2,26-28H2,3-8H3/t35?,36?,37?,38-/m1/s1 |
| InChIKey | ILJFKIMIACNBIO-XIGYLGKGSA-N |
| XLogP | 9.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.92 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|