C43H46O6Si — CID 102478524
(2R,3S,4S,5R)-2-[tert-butyl(diphenyl)silyl]oxy-3,4,5-tris(phenylmethoxy)hexanedial (PubChem CID 102478524) has the molecular formula C43H46O6Si and a molecular weight of 686.92 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-[tert-butyl(diphenyl)silyl]oxy-3,4,5-tris(phenylmethoxy)hexanedial.
| Compound Name | (2R,3S,4S,5R)-2-[tert-butyl(diphenyl)silyl]oxy-3,4,5-tris(phenylmethoxy)hexanedial |
|---|---|
| PubChem CID | 102478524 |
| Molecular Formula | C43H46O6Si |
| Molecular Weight | 686.92 g/mol |
| Exact Mass | 686.31 |
| IUPAC Name | (2R,3S,4S,5R)-2-[tert-butyl(diphenyl)silyl]oxy-3,4,5-tris(phenylmethoxy)hexanedial |
| SMILES | CC(C)(C)[Si](O[C@@H](C=O)[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H](C=O)OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H46O6Si/c1-43(2,3)50(37-25-15-7-16-26-37,38-27-17-8-18-28-38)49-40(30-45)42(48-33-36-23-13-6-14-24-36)41(47-32-35-21-11-5-12-22-35)39(29-44)46-31-34-19-9-4-10-20-34/h4-30,39-42H,31-33H2,1-3H3/t39-,40-,41+,42+/m0/s1 |
| InChIKey | IVXKWRGGNXUQFK-ATUXXYJQSA-N |
| XLogP | 7.09 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.92 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|