C13H28OS2Si — CID 11185456
tert-butyl-[(2S)-2-(1,3-dithian-2-yl)propoxy]-dimethylsilane (PubChem CID 11185456) has the molecular formula C13H28OS2Si and a molecular weight of 292.59 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-(1,3-dithian-2-yl)propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S)-2-(1,3-dithian-2-yl)propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11185456 |
| Molecular Formula | C13H28OS2Si |
| Molecular Weight | 292.59 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | tert-butyl-[(2S)-2-(1,3-dithian-2-yl)propoxy]-dimethylsilane |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)C1SCCCS1 |
| InChI | InChI=1S/C13H28OS2Si/c1-11(12-15-8-7-9-16-12)10-14-17(5,6)13(2,3)4/h11-12H,7-10H2,1-6H3/t11-/m0/s1 |
| InChIKey | JAMNOQZVRXRZBP-NSHDSACASA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|