C16H34O3S2Si — CID 133083358
tert-butyl-[(3R)-3-(1,3-dithiolan-2-yl)-3-(methoxymethoxy)-2,2-dimethylpropoxy]-dimethylsilane (PubChem CID 133083358) has the molecular formula C16H34O3S2Si and a molecular weight of 366.67 g/mol. Its IUPAC name is tert-butyl-[(3R)-3-(1,3-dithiolan-2-yl)-3-(methoxymethoxy)-2,2-dimethylpropoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3R)-3-(1,3-dithiolan-2-yl)-3-(methoxymethoxy)-2,2-dimethylpropoxy]-dimethylsilane |
|---|---|
| PubChem CID | 133083358 |
| Molecular Formula | C16H34O3S2Si |
| Molecular Weight | 366.67 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | tert-butyl-[(3R)-3-(1,3-dithiolan-2-yl)-3-(methoxymethoxy)-2,2-dimethylpropoxy]-dimethylsilane |
| SMILES | COCO[C@@H](C1SCCS1)C(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O3S2Si/c1-15(2,3)22(7,8)19-11-16(4,5)13(18-12-17-6)14-20-9-10-21-14/h13-14H,9-12H2,1-8H3/t13-/m0/s1 |
| InChIKey | NUKLKYMMUAKIQL-ZDUSSCGKSA-N |
| XLogP | 4.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.67 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|