C13H28O3Si — CID 102015279
5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4-dimethylpentanal (PubChem CID 102015279) has the molecular formula C13H28O3Si and a molecular weight of 260.45 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4-dimethylpentanal.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4-dimethylpentanal |
|---|---|
| PubChem CID | 102015279 |
| Molecular Formula | C13H28O3Si |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4-dimethylpentanal |
| SMILES | CC(C)(CO[Si](C)(C)C(C)(C)C)C(O)CC=O |
| InChI | InChI=1S/C13H28O3Si/c1-12(2,3)17(6,7)16-10-13(4,5)11(15)8-9-14/h9,11,15H,8,10H2,1-7H3 |
| InChIKey | WGDIAAKSNXFWEY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|