C11H25NO2Si — CID 121006548
(NE)-N-[3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropylidene]hydroxylamine (PubChem CID 121006548) has the molecular formula C11H25NO2Si and a molecular weight of 231.41 g/mol. Its IUPAC name is (NE)-N-[3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropylidene]hydroxylamine.
| Compound Name | (NE)-N-[3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropylidene]hydroxylamine |
|---|---|
| PubChem CID | 121006548 |
| Molecular Formula | C11H25NO2Si |
| Molecular Weight | 231.41 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (NE)-N-[3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylpropylidene]hydroxylamine |
| SMILES | CC(C)(/C=N/O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H25NO2Si/c1-10(2,3)15(6,7)14-9-11(4,5)8-12-13/h8,13H,9H2,1-7H3/b12-8+ |
| InChIKey | LGEGMCIUXNTSIS-XYOKQWHBSA-N |
| XLogP | 3.49 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|