C14H25NO3Si — CID 131743461
5-[tert-butyl(dimethyl)silyl]oxy-2-cyano-4,4-dimethylpent-2-enoic acid (PubChem CID 131743461) has the molecular formula C14H25NO3Si and a molecular weight of 283.44 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-2-cyano-4,4-dimethylpent-2-enoic acid.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-2-cyano-4,4-dimethylpent-2-enoic acid |
|---|---|
| PubChem CID | 131743461 |
| Molecular Formula | C14H25NO3Si |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-2-cyano-4,4-dimethylpent-2-enoic acid |
| SMILES | CC(C)(C=C(C#N)C(=O)O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H25NO3Si/c1-13(2,3)19(6,7)18-10-14(4,5)8-11(9-15)12(16)17/h8H,10H2,1-7H3,(H,16,17) |
| InChIKey | SVHOYVXISMMLCO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|