C13H25NOSi — CID 101169649
(E)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylpent-2-enenitrile (PubChem CID 101169649) has the molecular formula C13H25NOSi and a molecular weight of 239.43 g/mol. Its IUPAC name is (E)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylpent-2-enenitrile.
| Compound Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 101169649 |
| Molecular Formula | C13H25NOSi |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylpent-2-enenitrile |
| SMILES | CC(C)(/C=C/C#N)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25NOSi/c1-12(2,3)16(6,7)15-11-13(4,5)9-8-10-14/h8-9H,11H2,1-7H3/b9-8+ |
| InChIKey | HJLBTAIWFCIPIX-CMDGGOBGSA-N |
| XLogP | 4.11 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|