C13H25NOSi — CID 123172359
5-[tert-butyl(dimethyl)silyl]oxyhept-2-enenitrile (PubChem CID 123172359) has the molecular formula C13H25NOSi and a molecular weight of 239.43 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxyhept-2-enenitrile.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxyhept-2-enenitrile |
|---|---|
| PubChem CID | 123172359 |
| Molecular Formula | C13H25NOSi |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxyhept-2-enenitrile |
| SMILES | CCC(CC=CC#N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25NOSi/c1-7-12(10-8-9-11-14)15-16(5,6)13(2,3)4/h8-9,12H,7,10H2,1-6H3 |
| InChIKey | CTTCGTOTSAOARR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|