C10H20ClNOSi — CID 5097328
3-[tert-butyl(dimethyl)silyl]oxy-4-chlorobutanenitrile (PubChem CID 5097328) has the molecular formula C10H20ClNOSi and a molecular weight of 233.81 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-4-chlorobutanenitrile.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-4-chlorobutanenitrile |
|---|---|
| PubChem CID | 5097328 |
| Molecular Formula | C10H20ClNOSi |
| Molecular Weight | 233.81 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-4-chlorobutanenitrile |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCl)CC#N |
| InChI | InChI=1S/C10H20ClNOSi/c1-10(2,3)14(4,5)13-9(8-11)6-7-12/h9H,6,8H2,1-5H3 |
| InChIKey | CLSDDCUBUAXIFQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.81 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|