C19H41NO2Si2 — CID 101210753
(3R,4R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhexanenitrile (PubChem CID 101210753) has the molecular formula C19H41NO2Si2 and a molecular weight of 371.71 g/mol. Its IUPAC name is (3R,4R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhexanenitrile.
| Compound Name | (3R,4R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhexanenitrile |
|---|---|
| PubChem CID | 101210753 |
| Molecular Formula | C19H41NO2Si2 |
| Molecular Weight | 371.71 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | (3R,4R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhexanenitrile |
| SMILES | C[C@H](CC#N)[C@@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H41NO2Si2/c1-16(12-14-20)17(22-24(10,11)19(5,6)7)13-15-21-23(8,9)18(2,3)4/h16-17H,12-13,15H2,1-11H3/t16-,17-/m1/s1 |
| InChIKey | HPAKLPLIQCUPPB-IAGOWNOFSA-N |
| XLogP | 6.34 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.71 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|