C28H62O3Si4 — CID 10530881
trimethyl-[(3R,4S)-3,4,7-tris[[tert-butyl(dimethyl)silyl]oxy]hept-1-ynyl]silane (PubChem CID 10530881) has the molecular formula C28H62O3Si4 and a molecular weight of 559.15 g/mol. Its IUPAC name is trimethyl-[(3R,4S)-3,4,7-tris[[tert-butyl(dimethyl)silyl]oxy]hept-1-ynyl]silane.
| Compound Name | trimethyl-[(3R,4S)-3,4,7-tris[[tert-butyl(dimethyl)silyl]oxy]hept-1-ynyl]silane |
|---|---|
| PubChem CID | 10530881 |
| Molecular Formula | C28H62O3Si4 |
| Molecular Weight | 559.15 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | trimethyl-[(3R,4S)-3,4,7-tris[[tert-butyl(dimethyl)silyl]oxy]hept-1-ynyl]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H62O3Si4/c1-26(2,3)33(13,14)29-22-19-20-24(30-34(15,16)27(4,5)6)25(21-23-32(10,11)12)31-35(17,18)28(7,8)9/h24-25H,19-20,22H2,1-18H3/t24-,25+/m0/s1 |
| InChIKey | XVVAHHBOJCIXFP-LOSJGSFVSA-N |
| XLogP | 9.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.15 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|