C22H44O3Si2 — CID 123979390
11-[tert-butyl(dimethyl)silyl]oxy-3-(2-trimethylsilylethynyl)undecanoic acid (PubChem CID 123979390) has the molecular formula C22H44O3Si2 and a molecular weight of 412.76 g/mol. Its IUPAC name is 11-[tert-butyl(dimethyl)silyl]oxy-3-(2-trimethylsilylethynyl)undecanoic acid.
| Compound Name | 11-[tert-butyl(dimethyl)silyl]oxy-3-(2-trimethylsilylethynyl)undecanoic acid |
|---|---|
| PubChem CID | 123979390 |
| Molecular Formula | C22H44O3Si2 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 11-[tert-butyl(dimethyl)silyl]oxy-3-(2-trimethylsilylethynyl)undecanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCCCC(C#C[Si](C)(C)C)CC(=O)O |
| InChI | InChI=1S/C22H44O3Si2/c1-22(2,3)27(7,8)25-17-14-12-10-9-11-13-15-20(19-21(23)24)16-18-26(4,5)6/h20H,9-15,17,19H2,1-8H3,(H,23,24) |
| InChIKey | WGRSCZSSCWOVRE-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|