C27H55ClO2Si3 — CID 146169806
[(3R,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-chlorododec-11-en-1-ynyl]-trimethylsilane (PubChem CID 146169806) has the molecular formula C27H55ClO2Si3 and a molecular weight of 531.45 g/mol. Its IUPAC name is [(3R,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-chlorododec-11-en-1-ynyl]-trimethylsilane.
| Compound Name | [(3R,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-chlorododec-11-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 146169806 |
| Molecular Formula | C27H55ClO2Si3 |
| Molecular Weight | 531.45 g/mol |
| Exact Mass | 530.32 |
| IUPAC Name | [(3R,4R,5S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-chlorododec-11-en-1-ynyl]-trimethylsilane |
| SMILES | C=CCCCCC[C@H](Cl)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H55ClO2Si3/c1-15-16-17-18-19-20-23(28)25(30-33(13,14)27(5,6)7)24(21-22-31(8,9)10)29-32(11,12)26(2,3)4/h15,23-25H,1,16-20H2,2-14H3/t23-,24+,25-/m0/s1 |
| InChIKey | TXNZLVLQIYVOQR-GVAUOCQISA-N |
| XLogP | 9.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.45 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|