C25H50O2Si3 — CID 10837963
[(3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-4-prop-2-enylhept-6-en-1-ynyl]-trimethylsilane (PubChem CID 10837963) has the molecular formula C25H50O2Si3 and a molecular weight of 466.93 g/mol. Its IUPAC name is [(3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-4-prop-2-enylhept-6-en-1-ynyl]-trimethylsilane.
| Compound Name | [(3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-4-prop-2-enylhept-6-en-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10837963 |
| Molecular Formula | C25H50O2Si3 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | [(3R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-4-prop-2-enylhept-6-en-1-ynyl]-trimethylsilane |
| SMILES | C=CCC(CC=C)(O[Si](C)(C)C(C)(C)C)[C@@H](C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O2Si3/c1-16-19-25(20-17-2,27-30(14,15)24(6,7)8)22(18-21-28(9,10)11)26-29(12,13)23(3,4)5/h16-17,22H,1-2,19-20H2,3-15H3/t22-/m1/s1 |
| InChIKey | BKPSLTBBYNSFPF-JOCHJYFZSA-N |
| XLogP | 8.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|