C19H43BO4Si2 — CID 134887511
[(E,3R,4S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhex-1-enyl]boronic acid (PubChem CID 134887511) has the molecular formula C19H43BO4Si2 and a molecular weight of 402.53 g/mol. Its IUPAC name is [(E,3R,4S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhex-1-enyl]boronic acid.
| Compound Name | [(E,3R,4S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhex-1-enyl]boronic acid |
|---|---|
| PubChem CID | 134887511 |
| Molecular Formula | C19H43BO4Si2 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | [(E,3R,4S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-methylhex-1-enyl]boronic acid |
| SMILES | C[C@H](/C=C/B(O)O)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H43BO4Si2/c1-16(12-14-20(21)22)17(24-26(10,11)19(5,6)7)13-15-23-25(8,9)18(2,3)4/h12,14,16-17,21-22H,13,15H2,1-11H3/b14-12+/t16-,17+/m1/s1 |
| InChIKey | HIIMYWYFAJNLGR-KSUAYFRJSA-N |
| XLogP | 4.99 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|