C14H26F2N2O3Si — CID 176610763
[3-[tert-butyl(dimethyl)silyl]oxy-1-cyanobutan-2-yl] N-(2,2-difluoroethyl)carbamate (PubChem CID 176610763) has the molecular formula C14H26F2N2O3Si and a molecular weight of 336.46 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxy-1-cyanobutan-2-yl] N-(2,2-difluoroethyl)carbamate.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxy-1-cyanobutan-2-yl] N-(2,2-difluoroethyl)carbamate |
|---|---|
| PubChem CID | 176610763 |
| Molecular Formula | C14H26F2N2O3Si |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxy-1-cyanobutan-2-yl] N-(2,2-difluoroethyl)carbamate |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)C(CC#N)OC(=O)NCC(F)F |
| InChI | InChI=1S/C14H26F2N2O3Si/c1-10(21-22(5,6)14(2,3)4)11(7-8-17)20-13(19)18-9-12(15)16/h10-12H,7,9H2,1-6H3,(H,18,19) |
| InChIKey | MRVOXGLAKYAXDU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|