C12H27F2NO2Si — CID 169181755
3-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-difluoroethylamino)butan-1-ol (PubChem CID 169181755) has the molecular formula C12H27F2NO2Si and a molecular weight of 283.44 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-difluoroethylamino)butan-1-ol.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-difluoroethylamino)butan-1-ol |
|---|---|
| PubChem CID | 169181755 |
| Molecular Formula | C12H27F2NO2Si |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-2-(2,2-difluoroethylamino)butan-1-ol |
| SMILES | CC(O[Si](C)(C)C(C)(C)C)C(CO)NCC(F)F |
| InChI | InChI=1S/C12H27F2NO2Si/c1-9(10(8-16)15-7-11(13)14)17-18(5,6)12(2,3)4/h9-11,15-16H,7-8H2,1-6H3 |
| InChIKey | CQLAHLNYHMTKNV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|