C11H21F2NO3 — CID 169181575
(3S)-2-(2,2-difluoroethylamino)-3-(oxan-2-yloxy)butan-1-ol (PubChem CID 169181575) has the molecular formula C11H21F2NO3 and a molecular weight of 253.29 g/mol. Its IUPAC name is (3S)-2-(2,2-difluoroethylamino)-3-(oxan-2-yloxy)butan-1-ol.
| Compound Name | (3S)-2-(2,2-difluoroethylamino)-3-(oxan-2-yloxy)butan-1-ol |
|---|---|
| PubChem CID | 169181575 |
| Molecular Formula | C11H21F2NO3 |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (3S)-2-(2,2-difluoroethylamino)-3-(oxan-2-yloxy)butan-1-ol |
| SMILES | C[C@H](OC1CCCCO1)C(CO)NCC(F)F |
| InChI | InChI=1S/C11H21F2NO3/c1-8(9(7-15)14-6-10(12)13)17-11-4-2-3-5-16-11/h8-11,14-15H,2-7H2,1H3/t8-,9?,11?/m0/s1 |
| InChIKey | WTBWJGBALFAPHF-SILCLGDVSA-N |
| XLogP | 1.13 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |