C10H21NO3 — CID 167158778
(2R,3R,4R)-3-amino-4-[(2S)-oxan-2-yl]oxypentan-2-ol (PubChem CID 167158778) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is (2R,3R,4R)-3-amino-4-[(2S)-oxan-2-yl]oxypentan-2-ol.
| Compound Name | (2R,3R,4R)-3-amino-4-[(2S)-oxan-2-yl]oxypentan-2-ol |
|---|---|
| PubChem CID | 167158778 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | (2R,3R,4R)-3-amino-4-[(2S)-oxan-2-yl]oxypentan-2-ol |
| SMILES | C[C@@H](O)[C@@H](N)[C@@H](C)O[C@H]1CCCCO1 |
| InChI | InChI=1S/C10H21NO3/c1-7(12)10(11)8(2)14-9-5-3-4-6-13-9/h7-10,12H,3-6,11H2,1-2H3/t7-,8-,9+,10-/m1/s1 |
| InChIKey | FROFLHCTZMSSQI-DOLQZWNJSA-N |
| XLogP | 0.63 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |