C10H20O4 — CID 54016843
(2S,3S)-2-methyl-3-(oxan-2-yloxy)butane-1,4-diol (PubChem CID 54016843) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2S,3S)-2-methyl-3-(oxan-2-yloxy)butane-1,4-diol.
| Compound Name | (2S,3S)-2-methyl-3-(oxan-2-yloxy)butane-1,4-diol |
|---|---|
| PubChem CID | 54016843 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | (2S,3S)-2-methyl-3-(oxan-2-yloxy)butane-1,4-diol |
| SMILES | C[C@@H](CO)[C@@H](CO)OC1CCCCO1 |
| InChI | InChI=1S/C10H20O4/c1-8(6-11)9(7-12)14-10-4-2-3-5-13-10/h8-12H,2-7H2,1H3/t8-,9+,10?/m0/s1 |
| InChIKey | KWFNQUKQMOJUPL-QIIDTADFSA-N |
| XLogP | 0.52 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |